3,3-dimethyl-5-oxo-5-(2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)pentanoic acid
Chemical Structure Depiction of
3,3-dimethyl-5-oxo-5-(2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)pentanoic acid
3,3-dimethyl-5-oxo-5-(2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)pentanoic acid
Compound characteristics
| Compound ID: | 8018-7164 |
| Compound Name: | 3,3-dimethyl-5-oxo-5-(2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)pentanoic acid |
| Molecular Weight: | 289.37 |
| Molecular Formula: | C17 H23 N O3 |
| Smiles: | CC(C)(CC(O)=O)CC(N1CCCCc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0561 |
| logD: | 0.5203 |
| logSw: | -3.2288 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.01 |
| InChI Key: | JJRXSJFAOPYJOK-UHFFFAOYSA-N |