ethyl 3-amino-4-[(2H-1,3-benzodioxol-5-yl)oxy]benzoate
					Chemical Structure Depiction of
ethyl 3-amino-4-[(2H-1,3-benzodioxol-5-yl)oxy]benzoate
			ethyl 3-amino-4-[(2H-1,3-benzodioxol-5-yl)oxy]benzoate
Compound characteristics
| Compound ID: | 8018-7198 | 
| Compound Name: | ethyl 3-amino-4-[(2H-1,3-benzodioxol-5-yl)oxy]benzoate | 
| Molecular Weight: | 301.3 | 
| Molecular Formula: | C16 H15 N O5 | 
| Smiles: | CCOC(c1ccc(c(c1)N)Oc1ccc2c(c1)OCO2)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.2823 | 
| logD: | 3.2823 | 
| logSw: | -3.4147 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 65.038 | 
| InChI Key: | QUFSIDPXKMUZQP-UHFFFAOYSA-N | 
 
				 
				