N-(3-chloro-4-fluorophenyl)-2-hydroxybenzamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-2-hydroxybenzamide
N-(3-chloro-4-fluorophenyl)-2-hydroxybenzamide
Compound characteristics
| Compound ID: | 8018-7220 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-2-hydroxybenzamide |
| Molecular Weight: | 265.67 |
| Molecular Formula: | C13 H9 Cl F N O2 |
| Smiles: | c1ccc(c(c1)C(Nc1ccc(c(c1)[Cl])F)=O)O |
| Stereo: | ACHIRAL |
| logP: | 3.9589 |
| logD: | 3.2534 |
| logSw: | -3.926 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.878 |
| InChI Key: | HYSCLYSSJBEBLQ-UHFFFAOYSA-N |