4-[N-(benzenesulfonyl)benzamido]-3-methylphenyl benzoate
Chemical Structure Depiction of
4-[N-(benzenesulfonyl)benzamido]-3-methylphenyl benzoate
4-[N-(benzenesulfonyl)benzamido]-3-methylphenyl benzoate
Compound characteristics
| Compound ID: | 8018-7367 |
| Compound Name: | 4-[N-(benzenesulfonyl)benzamido]-3-methylphenyl benzoate |
| Molecular Weight: | 471.53 |
| Molecular Formula: | C27 H21 N O5 S |
| Smiles: | Cc1cc(ccc1N(C(c1ccccc1)=O)S(c1ccccc1)(=O)=O)OC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2317 |
| logD: | 5.2317 |
| logSw: | -5.191 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.623 |
| InChI Key: | MSKZGYACCOGYDE-UHFFFAOYSA-N |