4-methoxyphenyl 2-aminobenzoate
Chemical Structure Depiction of
4-methoxyphenyl 2-aminobenzoate
4-methoxyphenyl 2-aminobenzoate
Compound characteristics
| Compound ID: | 8018-7997 |
| Compound Name: | 4-methoxyphenyl 2-aminobenzoate |
| Molecular Weight: | 243.26 |
| Molecular Formula: | C14 H13 N O3 |
| Smiles: | COc1ccc(cc1)OC(c1ccccc1N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9842 |
| logD: | 2.9842 |
| logSw: | -3.3896 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.256 |
| InChI Key: | LTTDMCVZRDICBS-UHFFFAOYSA-N |