1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid
Chemical Structure Depiction of
1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid
1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid
Compound characteristics
| Compound ID: | 8018-8510 |
| Compound Name: | 1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid |
| Molecular Weight: | 194.11 |
| Molecular Formula: | C6 H5 F3 N2 O2 |
| Smiles: | Cn1c(cc(C(O)=O)n1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 0.6182 |
| logD: | -1.8806 |
| logSw: | -0.6629 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.162 |
| InChI Key: | QMIUBFUPVMQMRE-UHFFFAOYSA-N |