3-(4-methoxyphenyl)-1,2-oxazole-5-carboxamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-1,2-oxazole-5-carboxamide
3-(4-methoxyphenyl)-1,2-oxazole-5-carboxamide
Compound characteristics
| Compound ID: | 8018-8682 |
| Compound Name: | 3-(4-methoxyphenyl)-1,2-oxazole-5-carboxamide |
| Molecular Weight: | 218.21 |
| Molecular Formula: | C11 H10 N2 O3 |
| Smiles: | COc1ccc(cc1)c1cc(C(N)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 1.6453 |
| logD: | 1.6453 |
| logSw: | -2.0537 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.376 |
| InChI Key: | ZOUFKTYWRMXNIO-UHFFFAOYSA-N |