ethyl N-(2-chlorobenzoyl)-3,3,3-trifluoro-2-{[2-(4-methoxyphenyl)ethyl]amino}alaninate
Chemical Structure Depiction of
ethyl N-(2-chlorobenzoyl)-3,3,3-trifluoro-2-{[2-(4-methoxyphenyl)ethyl]amino}alaninate
ethyl N-(2-chlorobenzoyl)-3,3,3-trifluoro-2-{[2-(4-methoxyphenyl)ethyl]amino}alaninate
Compound characteristics
| Compound ID: | 8018-8946 |
| Compound Name: | ethyl N-(2-chlorobenzoyl)-3,3,3-trifluoro-2-{[2-(4-methoxyphenyl)ethyl]amino}alaninate |
| Molecular Weight: | 458.86 |
| Molecular Formula: | C21 H22 Cl F3 N2 O4 |
| Smiles: | CCOC(C(C(F)(F)F)(NCCc1ccc(cc1)OC)NC(c1ccccc1[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2142 |
| logD: | 2.8568 |
| logSw: | -4.5364 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.988 |
| InChI Key: | ZGOBGIDEMHHQKC-HXUWFJFHSA-N |