N-{3-[(adamantan-1-yl)oxy]propyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{3-[(adamantan-1-yl)oxy]propyl}thiophene-2-carboxamide
N-{3-[(adamantan-1-yl)oxy]propyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | 8018-9272 |
| Compound Name: | N-{3-[(adamantan-1-yl)oxy]propyl}thiophene-2-carboxamide |
| Molecular Weight: | 319.46 |
| Molecular Formula: | C18 H25 N O2 S |
| Smiles: | C(CNC(c1cccs1)=O)COC12CC3CC(CC(C3)C2)C1 |
| Stereo: | ACHIRAL |
| logP: | 4.0685 |
| logD: | 4.0685 |
| logSw: | -4.1916 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.772 |
| InChI Key: | INDZLDAETJDBFK-UHFFFAOYSA-N |