N~2~-(3-cyclohexylpropanoyl)leucinamide
Chemical Structure Depiction of
N~2~-(3-cyclohexylpropanoyl)leucinamide
N~2~-(3-cyclohexylpropanoyl)leucinamide
Compound characteristics
| Compound ID: | 8018-9327 |
| Compound Name: | N~2~-(3-cyclohexylpropanoyl)leucinamide |
| Molecular Weight: | 268.4 |
| Molecular Formula: | C15 H28 N2 O2 |
| Smiles: | CC(C)CC(C(N)=O)NC(CCC1CCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1425 |
| logD: | 3.1425 |
| logSw: | -3.344 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 58.591 |
| InChI Key: | GPXFEEWREKSBLY-ZDUSSCGKSA-N |