[2-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl](phenyl)methanone
Chemical Structure Depiction of
[2-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl](phenyl)methanone
[2-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl](phenyl)methanone
Compound characteristics
| Compound ID: | 8018-9369 |
| Compound Name: | [2-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-3-yl](phenyl)methanone |
| Molecular Weight: | 410.43 |
| Molecular Formula: | C24 H18 N4 O3 |
| Smiles: | CC1=C(C(c2cccc(c2)[N+]([O-])=O)n2c3ccccc3nc2N1)C(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0979 |
| logD: | 5.0978 |
| logSw: | -5.0027 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.883 |
| InChI Key: | CQXLLTANEFKFQP-QFIPXVFZSA-N |