3-(4-chlorobenzene-1-sulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-amine
Chemical Structure Depiction of
3-(4-chlorobenzene-1-sulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-amine
3-(4-chlorobenzene-1-sulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-amine
Compound characteristics
| Compound ID: | 8019-0265 |
| Compound Name: | 3-(4-chlorobenzene-1-sulfonyl)-1-(2-methoxyethyl)-4,5-dimethyl-1H-pyrrol-2-amine |
| Molecular Weight: | 342.84 |
| Molecular Formula: | C15 H19 Cl N2 O3 S |
| Smiles: | Cc1c(c(N)n(CCOC)c1C)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4627 |
| logD: | 2.4627 |
| logSw: | -3.0538 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.28 |
| InChI Key: | KSGSHARFJZGTAY-UHFFFAOYSA-N |