1-[(3-chlorophenyl)methyl]-3-(4-fluorobenzene-1-sulfonyl)-4,5-dimethyl-1H-pyrrol-2-amine
Chemical Structure Depiction of
1-[(3-chlorophenyl)methyl]-3-(4-fluorobenzene-1-sulfonyl)-4,5-dimethyl-1H-pyrrol-2-amine
1-[(3-chlorophenyl)methyl]-3-(4-fluorobenzene-1-sulfonyl)-4,5-dimethyl-1H-pyrrol-2-amine
Compound characteristics
| Compound ID: | 8019-0368 |
| Compound Name: | 1-[(3-chlorophenyl)methyl]-3-(4-fluorobenzene-1-sulfonyl)-4,5-dimethyl-1H-pyrrol-2-amine |
| Molecular Weight: | 392.88 |
| Molecular Formula: | C19 H18 Cl F N2 O2 S |
| Smiles: | Cc1c(c(N)n(Cc2cccc(c2)[Cl])c1C)S(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1433 |
| logD: | 4.1433 |
| logSw: | -4.3649 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.688 |
| InChI Key: | QQJLRRWNGBNZPD-UHFFFAOYSA-N |