3-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)benzoic acid
Chemical Structure Depiction of
3-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)benzoic acid
3-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)benzoic acid
Compound characteristics
| Compound ID: | 8019-0474 |
| Compound Name: | 3-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)benzoic acid |
| Molecular Weight: | 364.28 |
| Molecular Formula: | C16 H11 F3 N4 O3 |
| Smiles: | C(c1nnnn1c1cccc(c1)C(F)(F)F)Oc1cccc(c1)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3468 |
| logD: | 0.4286 |
| logSw: | -3.4801 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.19 |
| InChI Key: | WJXHVKBFMOKTEQ-UHFFFAOYSA-N |