3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1H-1-benzothiophene-1,1-dione
Chemical Structure Depiction of
3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1H-1-benzothiophene-1,1-dione
3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1H-1-benzothiophene-1,1-dione
Compound characteristics
| Compound ID: | 8019-0560 |
| Compound Name: | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1H-1-benzothiophene-1,1-dione |
| Molecular Weight: | 295.4 |
| Molecular Formula: | C12 H9 N O2 S3 |
| Smiles: | Cc1csc(n1)SC1=CS(c2ccccc12)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7566 |
| logD: | 2.7566 |
| logSw: | -3.3704 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 37.952 |
| InChI Key: | XGZFXBYLJDANET-UHFFFAOYSA-N |