2-(morpholin-4-yl)-6-(pentafluoroethyl)-4,4-bis(trifluoromethyl)-4H-1,3,5-oxadiazine
Chemical Structure Depiction of
2-(morpholin-4-yl)-6-(pentafluoroethyl)-4,4-bis(trifluoromethyl)-4H-1,3,5-oxadiazine
2-(morpholin-4-yl)-6-(pentafluoroethyl)-4,4-bis(trifluoromethyl)-4H-1,3,5-oxadiazine
Compound characteristics
| Compound ID: | 8019-0787 |
| Compound Name: | 2-(morpholin-4-yl)-6-(pentafluoroethyl)-4,4-bis(trifluoromethyl)-4H-1,3,5-oxadiazine |
| Molecular Weight: | 423.18 |
| Molecular Formula: | C11 H8 F11 N3 O2 |
| Smiles: | C1COCCN1C1=NC(C(F)(F)F)(C(F)(F)F)N=C(C(C(F)(F)F)(F)F)O1 |
| Stereo: | ACHIRAL |
| logP: | 2.7667 |
| logD: | 2.7636 |
| logSw: | -2.7542 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.533 |
| InChI Key: | YMYYQQXQJLALOO-UHFFFAOYSA-N |