N-[2-(benzyloxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide
Chemical Structure Depiction of
N-[2-(benzyloxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide
N-[2-(benzyloxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide
Compound characteristics
| Compound ID: | 8019-0802 |
| Compound Name: | N-[2-(benzyloxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| Molecular Weight: | 451.21 |
| Molecular Formula: | C14 H9 F12 N O2 |
| Smiles: | C(c1ccccc1)OC(C(F)(F)F)(C(F)(F)F)NC(C(C(F)(F)F)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2013 |
| logD: | 2.1156 |
| logSw: | -5.4801 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.052 |
| InChI Key: | YFYMZKJZQDWXCW-UHFFFAOYSA-N |