N-(4-chlorophenyl)-N'-[4-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-(4-chlorophenyl)-N'-[4-(trifluoromethyl)phenyl]urea
N-(4-chlorophenyl)-N'-[4-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | 8019-0813 |
| Compound Name: | N-(4-chlorophenyl)-N'-[4-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 314.69 |
| Molecular Formula: | C14 H10 Cl F3 N2 O |
| Smiles: | c1cc(ccc1C(F)(F)F)NC(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1389 |
| logD: | 5.1389 |
| logSw: | -5.9143 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.541 |
| InChI Key: | SRNBTVMPEGZWIW-UHFFFAOYSA-N |