N-(3-methylphenyl)-N'-(4-methylphenyl)urea
Chemical Structure Depiction of
N-(3-methylphenyl)-N'-(4-methylphenyl)urea
N-(3-methylphenyl)-N'-(4-methylphenyl)urea
Compound characteristics
| Compound ID: | 8019-0849 |
| Compound Name: | N-(3-methylphenyl)-N'-(4-methylphenyl)urea |
| Molecular Weight: | 240.3 |
| Molecular Formula: | C15 H16 N2 O |
| Smiles: | Cc1ccc(cc1)NC(Nc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4548 |
| logD: | 4.4548 |
| logSw: | -4.3546 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.541 |
| InChI Key: | PRVCBVJGABWHPY-UHFFFAOYSA-N |