4-tert-butyl-N-[1-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]benzamide
Chemical Structure Depiction of
4-tert-butyl-N-[1-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]benzamide
4-tert-butyl-N-[1-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]benzamide
Compound characteristics
| Compound ID: | 8019-1035 |
| Compound Name: | 4-tert-butyl-N-[1-(3-chloro-4-fluorophenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]benzamide |
| Molecular Weight: | 550.98 |
| Molecular Formula: | C28 H27 Cl F4 N2 O3 |
| Smiles: | CC1(C)CC2=C(C(C1)=O)C(C(N2c1ccc(c(c1)[Cl])F)=O)(C(F)(F)F)NC(c1ccc(cc1)C(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3058 |
| logD: | 0.5446 |
| logSw: | -6.2682 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.711 |
| InChI Key: | CMFKIEJWHRJNTF-MHZLTWQESA-N |