N-(3-chloro-4-fluorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-phenylurea
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-phenylurea
N-(3-chloro-4-fluorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-phenylurea
Compound characteristics
| Compound ID: | 8019-1234 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-phenylurea |
| Molecular Weight: | 363.84 |
| Molecular Formula: | C17 H15 Cl F N3 O S |
| Smiles: | CC1CN=C(N(C(Nc2ccccc2)=O)c2ccc(c(c2)[Cl])F)S1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5032 |
| logD: | 4.502 |
| logSw: | -4.6005 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.739 |
| InChI Key: | SMDCGWAGYNDFFR-LLVKDONJSA-N |