N-[2-(butylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide
Chemical Structure Depiction of
N-[2-(butylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide
N-[2-(butylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide
Compound characteristics
| Compound ID: | 8019-1241 |
| Compound Name: | N-[2-(butylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
| Molecular Weight: | 342.28 |
| Molecular Formula: | C14 H16 F6 N2 O |
| Smiles: | CCCCNC(C(F)(F)F)(C(F)(F)F)NC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0183 |
| logD: | -0.2308 |
| logSw: | -3.9634 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.962 |
| InChI Key: | RLTGMNMYPYENAO-UHFFFAOYSA-N |