ethyl N-benzoyl-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]alaninate
Chemical Structure Depiction of
ethyl N-benzoyl-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]alaninate
ethyl N-benzoyl-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]alaninate
Compound characteristics
| Compound ID: | 8019-1280 |
| Compound Name: | ethyl N-benzoyl-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]alaninate |
| Molecular Weight: | 434.34 |
| Molecular Formula: | C19 H16 F6 N2 O3 |
| Smiles: | CCOC(C(C(F)(F)F)(NC(c1ccccc1)=O)Nc1ccccc1C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7823 |
| logD: | 3.5484 |
| logSw: | -4.5201 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.583 |
| InChI Key: | AGIHOVZXIQKHDW-KRWDZBQOSA-N |