ethyl N-acetyl-3,3,3-trifluoro-2-{[(2-methoxyphenyl)methyl]amino}alaninate
Chemical Structure Depiction of
ethyl N-acetyl-3,3,3-trifluoro-2-{[(2-methoxyphenyl)methyl]amino}alaninate
ethyl N-acetyl-3,3,3-trifluoro-2-{[(2-methoxyphenyl)methyl]amino}alaninate
Compound characteristics
| Compound ID: | 8019-1333 |
| Compound Name: | ethyl N-acetyl-3,3,3-trifluoro-2-{[(2-methoxyphenyl)methyl]amino}alaninate |
| Molecular Weight: | 348.32 |
| Molecular Formula: | C15 H19 F3 N2 O4 |
| Smiles: | CCOC(C(C(F)(F)F)(NCc1ccccc1OC)NC(C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1824 |
| logD: | 2.1581 |
| logSw: | -2.6716 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.404 |
| InChI Key: | DARINAFSFGCDGD-CQSZACIVSA-N |