N-(3,4-difluorophenyl)-N-(5,5-dimethyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-[3-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-(3,4-difluorophenyl)-N-(5,5-dimethyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-[3-(trifluoromethyl)phenyl]urea
N-(3,4-difluorophenyl)-N-(5,5-dimethyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-[3-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | 8019-1363 |
| Compound Name: | N-(3,4-difluorophenyl)-N-(5,5-dimethyl-4,5-dihydro-1,3-thiazol-2-yl)-N'-[3-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 429.41 |
| Molecular Formula: | C19 H16 F5 N3 O S |
| Smiles: | CC1(C)CN=C(N(C(Nc2cccc(c2)C(F)(F)F)=O)c2ccc(c(c2)F)F)S1 |
| Stereo: | ACHIRAL |
| logP: | 5.9338 |
| logD: | 5.6976 |
| logSw: | -5.6537 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.739 |
| InChI Key: | GCSZZXQHJXJOBF-UHFFFAOYSA-N |