N-[(pyridin-3-yl)methyl]-N'-(3,4,5-trimethoxyphenyl)urea
Chemical Structure Depiction of
N-[(pyridin-3-yl)methyl]-N'-(3,4,5-trimethoxyphenyl)urea
N-[(pyridin-3-yl)methyl]-N'-(3,4,5-trimethoxyphenyl)urea
Compound characteristics
| Compound ID: | 8019-1898 |
| Compound Name: | N-[(pyridin-3-yl)methyl]-N'-(3,4,5-trimethoxyphenyl)urea |
| Molecular Weight: | 317.34 |
| Molecular Formula: | C16 H19 N3 O4 |
| Smiles: | COc1cc(cc(c1OC)OC)NC(NCc1cccnc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0408 |
| logD: | 1.0397 |
| logSw: | -1.365 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.359 |
| InChI Key: | BUSQVWIYBQWAJC-UHFFFAOYSA-N |