1-{2-[2-methoxy-4-(prop-1-en-1-yl)phenoxy]ethyl}-1H-benzimidazole
Chemical Structure Depiction of
1-{2-[2-methoxy-4-(prop-1-en-1-yl)phenoxy]ethyl}-1H-benzimidazole
1-{2-[2-methoxy-4-(prop-1-en-1-yl)phenoxy]ethyl}-1H-benzimidazole
Compound characteristics
| Compound ID: | 8019-1910 |
| Compound Name: | 1-{2-[2-methoxy-4-(prop-1-en-1-yl)phenoxy]ethyl}-1H-benzimidazole |
| Molecular Weight: | 308.38 |
| Molecular Formula: | C19 H20 N2 O2 |
| Smiles: | C/C=C/c1ccc(c(c1)OC)OCCn1cnc2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.9424 |
| logD: | 3.9423 |
| logSw: | -4.0073 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.5364 |
| InChI Key: | GNHPUPJDWOASDP-UHFFFAOYSA-N |