1-{1-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}ethan-1-ol
Chemical Structure Depiction of
1-{1-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}ethan-1-ol
1-{1-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}ethan-1-ol
Compound characteristics
| Compound ID: | 8019-2186 |
| Compound Name: | 1-{1-[(2,6-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}ethan-1-ol |
| Molecular Weight: | 321.2 |
| Molecular Formula: | C16 H14 Cl2 N2 O |
| Smiles: | CC(c1nc2ccccc2n1Cc1c(cccc1[Cl])[Cl])O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.327 |
| logD: | 4.3229 |
| logSw: | -4.1024 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.1777 |
| InChI Key: | XSRQJQCUTJPEFK-JTQLQIEISA-N |