{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}methanol
Chemical Structure Depiction of
{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}methanol
{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}methanol
Compound characteristics
| Compound ID: | 8019-2258 |
| Compound Name: | {1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}methanol |
| Molecular Weight: | 296.37 |
| Molecular Formula: | C18 H20 N2 O2 |
| Smiles: | Cc1ccc(c(C)c1)OCCn1c2ccccc2nc1CO |
| Stereo: | ACHIRAL |
| logP: | 4.078 |
| logD: | 4.0778 |
| logSw: | -4.2559 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.741 |
| InChI Key: | JIWSBOJCPOPFCL-UHFFFAOYSA-N |