1-{2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyl}-4-methylpiperazine--oxalic acid (1/1)
Chemical Structure Depiction of
1-{2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyl}-4-methylpiperazine--oxalic acid (1/1)
1-{2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyl}-4-methylpiperazine--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 8019-3644 |
| Compound Name: | 1-{2-[4-(2-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyl}-4-methylpiperazine--oxalic acid (1/1) |
| Molecular Weight: | 436.55 |
| Molecular Formula: | C21 H34 N2 O2 |
| Salt: | HOOCCOOH |
| Smiles: | CC1(C)CC(CCN2CCN(C)CC2)(CCO1)c1ccccc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0197 |
| logD: | 2.205 |
| logSw: | -3.3544 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 22.1759 |
| InChI Key: | QNMAVQSYYBCKDZ-NRFANRHFSA-N |