7-(2,4-dichlorophenyl)-5-oxo-3-phenyl-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Chemical Structure Depiction of
7-(2,4-dichlorophenyl)-5-oxo-3-phenyl-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
7-(2,4-dichlorophenyl)-5-oxo-3-phenyl-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid
Compound characteristics
| Compound ID: | 8019-3672 |
| Compound Name: | 7-(2,4-dichlorophenyl)-5-oxo-3-phenyl-4,5,6,7-tetrahydrothieno[3,2-b]pyridine-2-carboxylic acid |
| Molecular Weight: | 418.3 |
| Molecular Formula: | C20 H13 Cl2 N O3 S |
| Smiles: | C1C(c2ccc(cc2[Cl])[Cl])c2c(c(c3ccccc3)c(C(O)=O)s2)NC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9053 |
| logD: | 3.1053 |
| logSw: | -4.7041 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.691 |
| InChI Key: | GESMDJDVTHXIOR-CYBMUJFWSA-N |