N-{2-[2-(4-chlorophenoxy)acetamido]ethyl}-3-(thiophen-2-yl)-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
N-{2-[2-(4-chlorophenoxy)acetamido]ethyl}-3-(thiophen-2-yl)-1,2,4-oxadiazole-5-carboxamide
N-{2-[2-(4-chlorophenoxy)acetamido]ethyl}-3-(thiophen-2-yl)-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | 8019-3742 |
| Compound Name: | N-{2-[2-(4-chlorophenoxy)acetamido]ethyl}-3-(thiophen-2-yl)-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 406.85 |
| Molecular Formula: | C17 H15 Cl N4 O4 S |
| Smiles: | C(CNC(c1nc(c2cccs2)no1)=O)NC(COc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.1432 |
| logD: | 2.1432 |
| logSw: | -2.9795 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.001 |
| InChI Key: | MAXOPCCRKXWHJJ-UHFFFAOYSA-N |