4-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N,N-dimethylbenzene-1-sulfonamide
Chemical Structure Depiction of
4-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N,N-dimethylbenzene-1-sulfonamide
4-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N,N-dimethylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8019-3860 |
| Compound Name: | 4-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N,N-dimethylbenzene-1-sulfonamide |
| Molecular Weight: | 391.46 |
| Molecular Formula: | C19 H22 F N3 O3 S |
| Smiles: | CN(C)S(c1ccc(cc1)C(N1CCN(CC1)c1ccccc1F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2535 |
| logD: | 2.2535 |
| logSw: | -2.5348 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.51 |
| InChI Key: | NYNYFUFENQEEKX-UHFFFAOYSA-N |