2-{2-[(adamantan-1-yl)amino]-2-oxoethoxy}-N-(1,3-thiazol-2-yl)benzamide
Chemical Structure Depiction of
2-{2-[(adamantan-1-yl)amino]-2-oxoethoxy}-N-(1,3-thiazol-2-yl)benzamide
2-{2-[(adamantan-1-yl)amino]-2-oxoethoxy}-N-(1,3-thiazol-2-yl)benzamide
Compound characteristics
| Compound ID: | 8019-3966 |
| Compound Name: | 2-{2-[(adamantan-1-yl)amino]-2-oxoethoxy}-N-(1,3-thiazol-2-yl)benzamide |
| Molecular Weight: | 411.52 |
| Molecular Formula: | C22 H25 N3 O3 S |
| Smiles: | C1C2CC3CC1CC(C2)(C3)NC(COc1ccccc1C(Nc1nccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0444 |
| logD: | 3.8713 |
| logSw: | -4.4114 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.289 |
| InChI Key: | BRFMLNLESVQPSL-UHFFFAOYSA-N |