2-phenyl-4-{2-[3-(trifluoromethyl)phenyl]hydrazinylidene}-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
2-phenyl-4-{2-[3-(trifluoromethyl)phenyl]hydrazinylidene}-1,3-oxazol-5(4H)-one
2-phenyl-4-{2-[3-(trifluoromethyl)phenyl]hydrazinylidene}-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 8019-4112 |
| Compound Name: | 2-phenyl-4-{2-[3-(trifluoromethyl)phenyl]hydrazinylidene}-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 333.27 |
| Molecular Formula: | C16 H10 F3 N3 O2 |
| Smiles: | c1ccc(cc1)C1=NC(/C(=O)O1)=N/Nc1cccc(c1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 3.9981 |
| logD: | 3.9976 |
| logSw: | -4.3504 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.477 |
| InChI Key: | GLUUAQNCPYUWHN-UHFFFAOYSA-N |