rel-(4R,5S)-4-azido-5-[(triphenylmethoxy)methyl]oxolan-2-one
Chemical Structure Depiction of
rel-(4R,5S)-4-azido-5-[(triphenylmethoxy)methyl]oxolan-2-one
rel-(4R,5S)-4-azido-5-[(triphenylmethoxy)methyl]oxolan-2-one
Compound characteristics
| Compound ID: | 8019-4376 |
| Compound Name: | rel-(4R,5S)-4-azido-5-[(triphenylmethoxy)methyl]oxolan-2-one |
| Molecular Weight: | 399.45 |
| Molecular Formula: | C24 H21 N3 O3 |
| Smiles: | C1C(=O)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1N=[N+]=[N-] |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 5.0193 |
| logD: | 5.0193 |
| logSw: | -4.9084 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 70.337 |
| InChI Key: | WTZXQZQYGIQSLZ-FGZHOGPDSA-N |