methyl 5-amino-1-(4-methoxyphenyl)-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
methyl 5-amino-1-(4-methoxyphenyl)-1H-1,2,3-triazole-4-carboxylate
methyl 5-amino-1-(4-methoxyphenyl)-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | 8019-4539 |
| Compound Name: | methyl 5-amino-1-(4-methoxyphenyl)-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 248.24 |
| Molecular Formula: | C11 H12 N4 O3 |
| Smiles: | COC(c1c(N)n(c2ccc(cc2)OC)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8585 |
| logD: | 0.8585 |
| logSw: | -1.4646 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.05 |
| InChI Key: | PLFKTDVYHSCDFX-UHFFFAOYSA-N |