ethyl [4,4'-bipiperidine]-1-carboxylate
Chemical Structure Depiction of
ethyl [4,4'-bipiperidine]-1-carboxylate
ethyl [4,4'-bipiperidine]-1-carboxylate
Compound characteristics
| Compound ID: | 8019-4580 |
| Compound Name: | ethyl [4,4'-bipiperidine]-1-carboxylate |
| Molecular Weight: | 240.34 |
| Molecular Formula: | C13 H24 N2 O2 |
| Smiles: | CCOC(N1CCC(CC1)C1CCNCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.769 |
| logD: | -1.7794 |
| logSw: | -1.0726 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.092 |
| InChI Key: | QUSZESQSWSUKQT-UHFFFAOYSA-N |