N-[4-(2-phenylhydrazinylidene)thiolan-3-yl]benzamide
Chemical Structure Depiction of
N-[4-(2-phenylhydrazinylidene)thiolan-3-yl]benzamide
N-[4-(2-phenylhydrazinylidene)thiolan-3-yl]benzamide
Compound characteristics
| Compound ID: | 8019-4675 |
| Compound Name: | N-[4-(2-phenylhydrazinylidene)thiolan-3-yl]benzamide |
| Molecular Weight: | 311.4 |
| Molecular Formula: | C17 H17 N3 O S |
| Smiles: | C1C(/C(CS1)=N/Nc1ccccc1)NC(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2885 |
| logD: | 3.2853 |
| logSw: | -3.5265 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.572 |
| InChI Key: | PHIIMDYTWRIWOQ-OAHLLOKOSA-N |