2-(4-fluorophenyl)-5,11-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
2-(4-fluorophenyl)-5,11-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
2-(4-fluorophenyl)-5,11-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | 8019-5830 |
| Compound Name: | 2-(4-fluorophenyl)-5,11-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 352.43 |
| Molecular Formula: | C19 H17 F N4 S |
| Smiles: | CC1CCCc2c1c1c3nc(c4ccc(cc4)F)nn3C(C)=Nc1s2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9972 |
| logD: | 4.9963 |
| logSw: | -4.7771 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 32.037 |
| InChI Key: | PSJDDPHGBGHAII-JTQLQIEISA-N |