2-(4-fluorophenyl)-5,10,10-trimethyl-10,11-dihydro-8H-pyrano[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
2-(4-fluorophenyl)-5,10,10-trimethyl-10,11-dihydro-8H-pyrano[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
2-(4-fluorophenyl)-5,10,10-trimethyl-10,11-dihydro-8H-pyrano[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | 8019-5897 |
| Compound Name: | 2-(4-fluorophenyl)-5,10,10-trimethyl-10,11-dihydro-8H-pyrano[4',3':4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 368.43 |
| Molecular Formula: | C19 H17 F N4 O S |
| Smiles: | CC1=Nc2c(c3CC(C)(C)OCc3s2)c2nc(c3ccc(cc3)F)nn12 |
| Stereo: | ACHIRAL |
| logP: | 4.4907 |
| logD: | 4.4906 |
| logSw: | -4.6451 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.734 |
| InChI Key: | KCNNRMGKSDTKIB-UHFFFAOYSA-N |