N-(3-cyano-5-ethyl-5-methyl-4,7-dihydro-5H-thieno[2,3-c]pyran-2-yl)butanamide
Chemical Structure Depiction of
N-(3-cyano-5-ethyl-5-methyl-4,7-dihydro-5H-thieno[2,3-c]pyran-2-yl)butanamide
N-(3-cyano-5-ethyl-5-methyl-4,7-dihydro-5H-thieno[2,3-c]pyran-2-yl)butanamide
Compound characteristics
| Compound ID: | 8019-5972 |
| Compound Name: | N-(3-cyano-5-ethyl-5-methyl-4,7-dihydro-5H-thieno[2,3-c]pyran-2-yl)butanamide |
| Molecular Weight: | 292.4 |
| Molecular Formula: | C15 H20 N2 O2 S |
| Smiles: | CCCC(Nc1c(C#N)c2CC(C)(CC)OCc2s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2966 |
| logD: | 1.9638 |
| logSw: | -3.4579 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.05 |
| InChI Key: | PVKJTHMUFZZBMC-HNNXBMFYSA-N |