methyl 3-{[2-(4-fluorophenyl)ethyl]sulfamoyl}thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-{[2-(4-fluorophenyl)ethyl]sulfamoyl}thiophene-2-carboxylate
methyl 3-{[2-(4-fluorophenyl)ethyl]sulfamoyl}thiophene-2-carboxylate
Compound characteristics
| Compound ID: | 8019-6170 |
| Compound Name: | methyl 3-{[2-(4-fluorophenyl)ethyl]sulfamoyl}thiophene-2-carboxylate |
| Molecular Weight: | 343.39 |
| Molecular Formula: | C14 H14 F N O4 S2 |
| Smiles: | COC(c1c(ccs1)S(NCCc1ccc(cc1)F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6495 |
| logD: | 2.6494 |
| logSw: | -3.0629 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.03 |
| InChI Key: | VTIZNSAGQNKLSZ-UHFFFAOYSA-N |