N-(2-aminoethyl)-5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
N-(2-aminoethyl)-5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2-carboxamide
N-(2-aminoethyl)-5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | 8019-6459 |
| Compound Name: | N-(2-aminoethyl)-5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 276.25 |
| Molecular Formula: | C12 H12 N4 O4 |
| Smiles: | C(CNC(c1nnc(c2ccc3c(c2)OCO3)o1)=O)N |
| Stereo: | ACHIRAL |
| logP: | -0.2307 |
| logD: | -2.1648 |
| logSw: | -1.8823 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 93.551 |
| InChI Key: | AYPGUCNVJZZMRT-UHFFFAOYSA-N |