6-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-6,7-dihydro-3H-imidazo[1,5-b][1,2,4]triazole-2,5-dione
Chemical Structure Depiction of
6-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-6,7-dihydro-3H-imidazo[1,5-b][1,2,4]triazole-2,5-dione
6-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-6,7-dihydro-3H-imidazo[1,5-b][1,2,4]triazole-2,5-dione
Compound characteristics
| Compound ID: | 8019-7001 |
| Compound Name: | 6-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-6,7-dihydro-3H-imidazo[1,5-b][1,2,4]triazole-2,5-dione |
| Molecular Weight: | 375.21 |
| Molecular Formula: | C17 H12 Cl2 N4 O2 |
| Smiles: | C1C2=NC(N(Cc3ccc(cc3)[Cl])N2C(N1c1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5272 |
| logD: | 3.5254 |
| logSw: | -3.6446 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.338 |
| InChI Key: | HDGMXWZEXSDKHE-UHFFFAOYSA-N |