1-(2,5-dimethoxyphenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(2,5-dimethoxyphenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione
1-(2,5-dimethoxyphenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8019-7024 |
| Compound Name: | 1-(2,5-dimethoxyphenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione |
| Molecular Weight: | 376.41 |
| Molecular Formula: | C19 H24 N2 O6 |
| Smiles: | COc1ccc(c(c1)N1C(CC(C1=O)N1CCC2(CC1)OCCO2)=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.6994 |
| logD: | 0.6994 |
| logSw: | -1.6998 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 61.298 |
| InChI Key: | VPVUPXHREYRDKQ-HNNXBMFYSA-N |