2-amino-N-(2,3-dimethylphenyl)benzamide
Chemical Structure Depiction of
2-amino-N-(2,3-dimethylphenyl)benzamide
2-amino-N-(2,3-dimethylphenyl)benzamide
Compound characteristics
| Compound ID: | 8019-7075 |
| Compound Name: | 2-amino-N-(2,3-dimethylphenyl)benzamide |
| Molecular Weight: | 240.3 |
| Molecular Formula: | C15 H16 N2 O |
| Smiles: | Cc1cccc(c1C)NC(c1ccccc1N)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3002 |
| logD: | 3.3002 |
| logSw: | -3.7587 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 42.728 |
| InChI Key: | HPTLYBZCELMYHK-UHFFFAOYSA-N |