1-[(2,4-dichlorophenyl)methyl]-1H-benzimidazole-2-carbaldehyde
Chemical Structure Depiction of
1-[(2,4-dichlorophenyl)methyl]-1H-benzimidazole-2-carbaldehyde
1-[(2,4-dichlorophenyl)methyl]-1H-benzimidazole-2-carbaldehyde
Compound characteristics
| Compound ID: | 8019-7093 |
| Compound Name: | 1-[(2,4-dichlorophenyl)methyl]-1H-benzimidazole-2-carbaldehyde |
| Molecular Weight: | 305.16 |
| Molecular Formula: | C15 H10 Cl2 N2 O |
| Smiles: | C(c1ccc(cc1[Cl])[Cl])n1c2ccccc2nc1C=O |
| Stereo: | ACHIRAL |
| logP: | 4.4912 |
| logD: | 4.4912 |
| logSw: | -4.4428 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.3024 |
| InChI Key: | XXVPOEGBQKITPG-UHFFFAOYSA-N |