N-(2,2-dimethylpropyl)-2-nitro-5-(piperazin-1-yl)aniline--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-(2,2-dimethylpropyl)-2-nitro-5-(piperazin-1-yl)aniline--hydrogen chloride (1/1)
N-(2,2-dimethylpropyl)-2-nitro-5-(piperazin-1-yl)aniline--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 8019-7123 |
| Compound Name: | N-(2,2-dimethylpropyl)-2-nitro-5-(piperazin-1-yl)aniline--hydrogen chloride (1/1) |
| Molecular Weight: | 328.84 |
| Molecular Formula: | C15 H24 N4 O2 |
| Salt: | HCl |
| Smiles: | CC(C)(C)CNc1cc(ccc1[N+]([O-])=O)N1CCNCC1 |
| Stereo: | ACHIRAL |
| logP: | 2.6902 |
| logD: | 1.3641 |
| logSw: | -3.0865 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.54 |
| InChI Key: | JOQNZYDQFZLBHC-UHFFFAOYSA-N |