N-[(4,7-dimethoxy-6-propyl-2H-1,3-benzodioxol-5-yl)methylidene]hydroxylamine
Chemical Structure Depiction of
N-[(4,7-dimethoxy-6-propyl-2H-1,3-benzodioxol-5-yl)methylidene]hydroxylamine
N-[(4,7-dimethoxy-6-propyl-2H-1,3-benzodioxol-5-yl)methylidene]hydroxylamine
Compound characteristics
| Compound ID: | 8019-7237 |
| Compound Name: | N-[(4,7-dimethoxy-6-propyl-2H-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
| Molecular Weight: | 267.28 |
| Molecular Formula: | C13 H17 N O5 |
| Smiles: | CCCc1c(/C=N/O)c(c2c(c1OC)OCO2)OC |
| Stereo: | ACHIRAL |
| logP: | 3.2803 |
| logD: | 3.2803 |
| logSw: | -3.1497 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.172 |
| InChI Key: | ZPLBKSBMUGDVNM-UHFFFAOYSA-N |